C19H24N6O3 — CID 140963657
[3-[(6,6-dimethyl-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)amino]piperidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 140963657) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is [3-[(6,6-dimethyl-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)amino]piperidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3-[(6,6-dimethyl-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)amino]piperidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 140963657 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [3-[(6,6-dimethyl-4,5-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl)amino]piperidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CC1(C)NCc2c(NC3CCCN(C(=O)c4ccc([N+](=O)[O-])cc4)C3)n[nH]c21 |
| InChI | InChI=1S/C19H24N6O3/c1-19(2)16-15(10-20-19)17(23-22-16)21-13-4-3-9-24(11-13)18(26)12-5-7-14(8-6-12)25(27)28/h5-8,13,20H,3-4,9-11H2,1-2H3,(H2,21,22,23) |
| InChIKey | YWKCAJKOUXZGHW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|