About ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol
ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol (PubChem CID 145114588) has the molecular formula C29H40O4
and a molecular weight of 452.64 g/mol. Its IUPAC name is ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol.
Molecular Properties
| Compound Name | ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol |
| PubChem CID | 145114588 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol |
| SMILES | CC.COc1ccc(CC(CCO)CC(C)OCc2ccccc2)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C21H28O3.C6H6O.C2H6/c1-17(24-16-19-6-4-3-5-7-19)14-20(12-13-22)15-18-8-10-21(23-2)11-9-18;7-6-4-2-1-3-5-6;1-2/h3-11,17,20,22H,12-16H2,1-2H3;1-5,7H;1-2H3 |
| InChIKey | SLMFPLZCYFRUNJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol?
The IUPAC name of ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol (CID 145114588) is ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol.
What is the SMILES notation for ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol?
The canonical SMILES for ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol is CC.COc1ccc(CC(CCO)CC(C)OCc2ccccc2)cc1.Oc1ccccc1.
What is the InChIKey of ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol?
The InChIKey is SLMFPLZCYFRUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28O3.C6H6O.C2H6/c1-17(24-16-19-6-4-3-5-7-19)14-20(12-13-22)15-18-8-10-21(23-2)11-9-18;7-6-4-2-1-3-5-6;1-2/h3-11,17,20,22H,12-16H2,1-2H3;1-5,7H;1-2H3.
What are the key properties of ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol?
ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol has a molecular weight of 452.64 g/mol, XLogP of 6.65, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(4-methoxyphenyl)methyl]-5-phenylmethoxyhexan-1-ol;phenol is sourced from PubChem (CID 145114588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).