C26H42N2O7 — CID 145115224
ethane;[4-methoxy-2-[[2-[(4E)-4-methylhepta-4,6-dien-2-yl]oxy-2-oxoethyl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate (PubChem CID 145115224) has the molecular formula C26H42N2O7 and a molecular weight of 494.63 g/mol. Its IUPAC name is ethane;[4-methoxy-2-[[2-[(4E)-4-methylhepta-4,6-dien-2-yl]oxy-2-oxoethyl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate.
| Compound Name | ethane;[4-methoxy-2-[[2-[(4E)-4-methylhepta-4,6-dien-2-yl]oxy-2-oxoethyl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 145115224 |
| Molecular Formula | C26H42N2O7 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | ethane;[4-methoxy-2-[[2-[(4E)-4-methylhepta-4,6-dien-2-yl]oxy-2-oxoethyl]carbamoyl]-3-pyridinyl]oxymethyl 2-methylpropanoate |
| SMILES | C=C/C=C(\C)CC(C)OC(=O)CNC(=O)c1nccc(OC)c1OCOC(=O)C(C)C.CC.CC |
| InChI | InChI=1S/C22H30N2O7.2C2H6/c1-7-8-15(4)11-16(5)31-18(25)12-24-21(26)19-20(17(28-6)9-10-23-19)29-13-30-22(27)14(2)3;2*1-2/h7-10,14,16H,1,11-13H2,2-6H3,(H,24,26);2*1-2H3/b15-8+;; |
| InChIKey | YGIDXFUEAJCISQ-OLIKVXRNSA-N |
| XLogP | 4.86 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|