C26H28N4O4S2 — CID 145116568
2-[3-[(4-aminosulfanylphenyl)methyl]-5-(morpholine-4-carbonyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid;ethane (PubChem CID 145116568) has the molecular formula C26H28N4O4S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(morpholine-4-carbonyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid;ethane.
| Compound Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(morpholine-4-carbonyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145116568 |
| Molecular Formula | C26H28N4O4S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(morpholine-4-carbonyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid;ethane |
| SMILES | CC.NSc1ccc(Cc2cn(-c3nc(C(=O)O)cs3)c3ccc(C(=O)N4CCOCC4)cc23)cc1 |
| InChI | InChI=1S/C24H22N4O4S2.C2H6/c25-34-18-4-1-15(2-5-18)11-17-13-28(24-26-20(14-33-24)23(30)31)21-6-3-16(12-19(17)21)22(29)27-7-9-32-10-8-27;1-2/h1-6,12-14H,7-11,25H2,(H,30,31);1-2H3 |
| InChIKey | MHJKJOPEYVMWSS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|