C24H23NO8 — CID 145121812
2-[4-[4-(2-methoxyethoxy)benzoyl]phenoxy]ethyl 2-(2,5-dioxopyrrol-1-yl)acetate (PubChem CID 145121812) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[4-[4-(2-methoxyethoxy)benzoyl]phenoxy]ethyl 2-(2,5-dioxopyrrol-1-yl)acetate.
| Compound Name | 2-[4-[4-(2-methoxyethoxy)benzoyl]phenoxy]ethyl 2-(2,5-dioxopyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 145121812 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[4-[4-(2-methoxyethoxy)benzoyl]phenoxy]ethyl 2-(2,5-dioxopyrrol-1-yl)acetate |
| SMILES | COCCOc1ccc(C(=O)c2ccc(OCCOC(=O)CN3C(=O)C=CC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H23NO8/c1-30-12-13-31-19-6-2-17(3-7-19)24(29)18-4-8-20(9-5-18)32-14-15-33-23(28)16-25-21(26)10-11-22(25)27/h2-11H,12-16H2,1H3 |
| InChIKey | YTYSHMBYHXODIB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|