C17H19FO2 — CID 145121911
[4-(2-fluoro-4-methylphenyl)-2-(2-methoxyethyl)phenyl]methanol (PubChem CID 145121911) has the molecular formula C17H19FO2 and a molecular weight of 274.34 g/mol. Its IUPAC name is [4-(2-fluoro-4-methylphenyl)-2-(2-methoxyethyl)phenyl]methanol.
| Compound Name | [4-(2-fluoro-4-methylphenyl)-2-(2-methoxyethyl)phenyl]methanol |
|---|---|
| PubChem CID | 145121911 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [4-(2-fluoro-4-methylphenyl)-2-(2-methoxyethyl)phenyl]methanol |
| SMILES | COCCc1cc(-c2ccc(C)cc2F)ccc1CO |
| InChI | InChI=1S/C17H19FO2/c1-12-3-6-16(17(18)9-12)14-4-5-15(11-19)13(10-14)7-8-20-2/h3-6,9-10,19H,7-8,11H2,1-2H3 |
| InChIKey | FDSPRIREFLUCIH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |