About ethane;tripyridin-2-ylborane
ethane;tripyridin-2-ylborane (PubChem CID 145126052) has the molecular formula C21H30BN3
and a molecular weight of 335.30 g/mol. Its IUPAC name is ethane;tripyridin-2-ylborane.
Molecular Properties
| Compound Name | ethane;tripyridin-2-ylborane |
| PubChem CID | 145126052 |
| Molecular Formula | C21H30BN3 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | ethane;tripyridin-2-ylborane |
| SMILES | CC.CC.CC.c1ccc(B(c2ccccn2)c2ccccn2)nc1 |
| InChI | InChI=1S/C15H12BN3.3C2H6/c1-4-10-17-13(7-1)16(14-8-2-5-11-18-14)15-9-3-6-12-19-15;3*1-2/h1-12H;3*1-2H3 |
| InChIKey | QCTZSLIESWRZCM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;tripyridin-2-ylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;tripyridin-2-ylborane?
The IUPAC name of ethane;tripyridin-2-ylborane (CID 145126052) is ethane;tripyridin-2-ylborane.
What is the SMILES notation for ethane;tripyridin-2-ylborane?
The canonical SMILES for ethane;tripyridin-2-ylborane is CC.CC.CC.c1ccc(B(c2ccccn2)c2ccccn2)nc1.
What is the InChIKey of ethane;tripyridin-2-ylborane?
The InChIKey is QCTZSLIESWRZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BN3.3C2H6/c1-4-10-17-13(7-1)16(14-8-2-5-11-18-14)15-9-3-6-12-19-15;3*1-2/h1-12H;3*1-2H3.
What are the key properties of ethane;tripyridin-2-ylborane?
ethane;tripyridin-2-ylborane has a molecular weight of 335.30 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;tripyridin-2-ylborane is sourced from PubChem (CID 145126052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).