C37H51N — CID 145126191
3,6-dibutyl-9-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methyl]carbazole (PubChem CID 145126191) has the molecular formula C37H51N and a molecular weight of 509.82 g/mol. Its IUPAC name is 3,6-dibutyl-9-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methyl]carbazole.
| Compound Name | 3,6-dibutyl-9-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methyl]carbazole |
|---|---|
| PubChem CID | 145126191 |
| Molecular Formula | C37H51N |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.40 |
| IUPAC Name | 3,6-dibutyl-9-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methyl]carbazole |
| SMILES | CCCCc1ccc2c(c1)c1cc(CCCC)ccc1n2Cc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H51N/c1-9-11-13-27-17-21-34-31(23-27)32-24-28(14-12-10-2)18-22-35(32)38(34)26-29-15-19-30(20-16-29)33(37(6,7)8)25-36(3,4)5/h15-24,33H,9-14,25-26H2,1-8H3 |
| InChIKey | HTDPLZHZJWUNRZ-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |