About ethane;2-ethylpyridine;3-methylbenzonitrile
ethane;2-ethylpyridine;3-methylbenzonitrile (PubChem CID 145128447) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is ethane;2-ethylpyridine;3-methylbenzonitrile.
Molecular Properties
| Compound Name | ethane;2-ethylpyridine;3-methylbenzonitrile |
| PubChem CID | 145128447 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | ethane;2-ethylpyridine;3-methylbenzonitrile |
| SMILES | CC.CCc1ccccn1.Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C8H7N.C7H9N.C2H6/c1-7-3-2-4-8(5-7)6-9;1-2-7-5-3-4-6-8-7;1-2/h2-5H,1H3;3-6H,2H2,1H3;1-2H3 |
| InChIKey | FZNLGVLGIUQLJP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethylpyridine;3-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylpyridine;3-methylbenzonitrile?
The IUPAC name of ethane;2-ethylpyridine;3-methylbenzonitrile (CID 145128447) is ethane;2-ethylpyridine;3-methylbenzonitrile.
What is the SMILES notation for ethane;2-ethylpyridine;3-methylbenzonitrile?
The canonical SMILES for ethane;2-ethylpyridine;3-methylbenzonitrile is CC.CCc1ccccn1.Cc1cccc(C#N)c1.
What is the InChIKey of ethane;2-ethylpyridine;3-methylbenzonitrile?
The InChIKey is FZNLGVLGIUQLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C7H9N.C2H6/c1-7-3-2-4-8(5-7)6-9;1-2-7-5-3-4-6-8-7;1-2/h2-5H,1H3;3-6H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-ethylpyridine;3-methylbenzonitrile?
ethane;2-ethylpyridine;3-methylbenzonitrile has a molecular weight of 254.38 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylpyridine;3-methylbenzonitrile is sourced from PubChem (CID 145128447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).