C25H28N2 — CID 143178266
N,N-dibenzylpropan-1-amine;3-methylbenzonitrile (PubChem CID 143178266) has the molecular formula C25H28N2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N,N-dibenzylpropan-1-amine;3-methylbenzonitrile.
| Compound Name | N,N-dibenzylpropan-1-amine;3-methylbenzonitrile |
|---|---|
| PubChem CID | 143178266 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N,N-dibenzylpropan-1-amine;3-methylbenzonitrile |
| SMILES | CCCN(Cc1ccccc1)Cc1ccccc1.Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H21N.C8H7N/c1-2-13-18(14-16-9-5-3-6-10-16)15-17-11-7-4-8-12-17;1-7-3-2-4-8(5-7)6-9/h3-12H,2,13-15H2,1H3;2-5H,1H3 |
| InChIKey | PMRIBQIIJUCYIM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |