C25H26N2O4 — CID 145130496
(2-methylphenyl)methyl 6-but-3-enyl-4-[(3R)-3-hydroxybut-1-ynyl]-2-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 145130496) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2-methylphenyl)methyl 6-but-3-enyl-4-[(3R)-3-hydroxybut-1-ynyl]-2-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate.
| Compound Name | (2-methylphenyl)methyl 6-but-3-enyl-4-[(3R)-3-hydroxybut-1-ynyl]-2-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 145130496 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2-methylphenyl)methyl 6-but-3-enyl-4-[(3R)-3-hydroxybut-1-ynyl]-2-methyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | C=CCCn1cc(C#C[C@@H](C)O)c2c(C(=O)OCc3ccccc3C)c(C)[nH]c2c1=O |
| InChI | InChI=1S/C25H26N2O4/c1-5-6-13-27-14-19(12-11-17(3)28)22-21(18(4)26-23(22)24(27)29)25(30)31-15-20-10-8-7-9-16(20)2/h5,7-10,14,17,26,28H,1,6,13,15H2,2-4H3/t17-/m1/s1 |
| InChIKey | ZCWLNLGASHGWJD-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|