C22H21ClN4O — CID 145131074
6-anilino-4-chloro-5-ethanimidoyl-N-(4-ethylphenyl)pyridine-3-carboxamide (PubChem CID 145131074) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-anilino-4-chloro-5-ethanimidoyl-N-(4-ethylphenyl)pyridine-3-carboxamide.
| Compound Name | 6-anilino-4-chloro-5-ethanimidoyl-N-(4-ethylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145131074 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-anilino-4-chloro-5-ethanimidoyl-N-(4-ethylphenyl)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(Nc2ccccc2)ncc(C(=O)Nc2ccc(CC)cc2)c1Cl |
| InChI | InChI=1S/C22H21ClN4O/c1-3-15-9-11-17(12-10-15)27-22(28)18-13-25-21(19(14(2)24)20(18)23)26-16-7-5-4-6-8-16/h4-13,24H,3H2,1-2H3,(H,25,26)(H,27,28)/b24-14+ |
| InChIKey | ZBRFFQKCTICLQE-ZVHZXABRSA-N |
| XLogP | 5.68 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|