C20H17Cl2N5O — CID 145130837
4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(pyridin-3-ylmethylamino)pyridine-3-carboxamide (PubChem CID 145130837) has the molecular formula C20H17Cl2N5O and a molecular weight of 414.30 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(pyridin-3-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(pyridin-3-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145130837 |
| Molecular Formula | C20H17Cl2N5O |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(pyridin-3-ylmethylamino)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(NCc2cccnc2)ncc(C(=O)Nc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C20H17Cl2N5O/c1-12(23)17-18(22)16(20(28)27-15-6-4-14(21)5-7-15)11-26-19(17)25-10-13-3-2-8-24-9-13/h2-9,11,23H,10H2,1H3,(H,25,26)(H,27,28)/b23-12+ |
| InChIKey | JHYUUOLFRZEPBN-FSJBWODESA-N |
| XLogP | 5.04 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|