C25H35ClN4O3 — CID 145130854
4-chloro-5-ethanimidoyl-N-[4-(9-methoxynonoxy)phenyl]-6-(methylamino)pyridine-3-carboxamide (PubChem CID 145130854) has the molecular formula C25H35ClN4O3 and a molecular weight of 475.03 g/mol. Its IUPAC name is 4-chloro-5-ethanimidoyl-N-[4-(9-methoxynonoxy)phenyl]-6-(methylamino)pyridine-3-carboxamide.
| Compound Name | 4-chloro-5-ethanimidoyl-N-[4-(9-methoxynonoxy)phenyl]-6-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145130854 |
| Molecular Formula | C25H35ClN4O3 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-chloro-5-ethanimidoyl-N-[4-(9-methoxynonoxy)phenyl]-6-(methylamino)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(NC)ncc(C(=O)Nc2ccc(OCCCCCCCCCOC)cc2)c1Cl |
| InChI | InChI=1S/C25H35ClN4O3/c1-18(27)22-23(26)21(17-29-24(22)28-2)25(31)30-19-11-13-20(14-12-19)33-16-10-8-6-4-5-7-9-15-32-3/h11-14,17,27H,4-10,15-16H2,1-3H3,(H,28,29)(H,30,31)/b27-18+ |
| InChIKey | YWMRBQIPSGQGKO-OVVQPSECSA-N |
| XLogP | 6.17 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|