C23H32ClN5O2 — CID 145131079
N-(4-chlorophenyl)-5-ethanimidoyl-4-methoxy-6-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxamide;ethane (PubChem CID 145131079) has the molecular formula C23H32ClN5O2 and a molecular weight of 446.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-ethanimidoyl-4-methoxy-6-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxamide;ethane.
| Compound Name | N-(4-chlorophenyl)-5-ethanimidoyl-4-methoxy-6-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 145131079 |
| Molecular Formula | C23H32ClN5O2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | N-(4-chlorophenyl)-5-ethanimidoyl-4-methoxy-6-[(1-methylpiperidin-4-yl)amino]pyridine-3-carboxamide;ethane |
| SMILES | CC.[H]/N=C(\C)c1c(NC2CCN(C)CC2)ncc(C(=O)Nc2ccc(Cl)cc2)c1OC |
| InChI | InChI=1S/C21H26ClN5O2.C2H6/c1-13(23)18-19(29-3)17(21(28)26-15-6-4-14(22)5-7-15)12-24-20(18)25-16-8-10-27(2)11-9-16;1-2/h4-7,12,16,23H,8-11H2,1-3H3,(H,24,25)(H,26,28);1-2H3/b23-13+; |
| InChIKey | XPAMQAWLYVQFIQ-PUZWSPMBSA-N |
| XLogP | 4.92 |
| TPSA | 90.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|