C19H21Cl2N5O — CID 145131051
4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(piperidin-4-ylamino)pyridine-3-carboxamide (PubChem CID 145131051) has the molecular formula C19H21Cl2N5O and a molecular weight of 406.32 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(piperidin-4-ylamino)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(piperidin-4-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145131051 |
| Molecular Formula | C19H21Cl2N5O |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-(piperidin-4-ylamino)pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(NC2CCNCC2)ncc(C(=O)Nc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C19H21Cl2N5O/c1-11(22)16-17(21)15(19(27)26-13-4-2-12(20)3-5-13)10-24-18(16)25-14-6-8-23-9-7-14/h2-5,10,14,22-23H,6-9H2,1H3,(H,24,25)(H,26,27)/b22-11+ |
| InChIKey | GHCNIXKBQUGQPX-SSDVNMTOSA-N |
| XLogP | 4.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|