C18H18Cl2N4OS — CID 145131031
4-chloro-N-(4-chlorophenyl)-5-methanimidoyl-6-(thian-4-ylamino)pyridine-3-carboxamide (PubChem CID 145131031) has the molecular formula C18H18Cl2N4OS and a molecular weight of 409.34 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-5-methanimidoyl-6-(thian-4-ylamino)pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-5-methanimidoyl-6-(thian-4-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145131031 |
| Molecular Formula | C18H18Cl2N4OS |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-5-methanimidoyl-6-(thian-4-ylamino)pyridine-3-carboxamide |
| SMILES | [H]/N=C/c1c(NC2CCSCC2)ncc(C(=O)Nc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C18H18Cl2N4OS/c19-11-1-3-12(4-2-11)24-18(25)15-10-22-17(14(9-21)16(15)20)23-13-5-7-26-8-6-13/h1-4,9-10,13,21H,5-8H2,(H,22,23)(H,24,25)/b21-9+ |
| InChIKey | QWSDZZAYLHFMLR-ZVBGSRNCSA-N |
| XLogP | 4.95 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|