C20H17ClN4O2 — CID 145131030
5-anilino-N-(4-chlorophenyl)-4-methanimidoyl-3-methoxypyridine-2-carboxamide (PubChem CID 145131030) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 5-anilino-N-(4-chlorophenyl)-4-methanimidoyl-3-methoxypyridine-2-carboxamide.
| Compound Name | 5-anilino-N-(4-chlorophenyl)-4-methanimidoyl-3-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 145131030 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 5-anilino-N-(4-chlorophenyl)-4-methanimidoyl-3-methoxypyridine-2-carboxamide |
| SMILES | [H]/N=C/c1c(Nc2ccccc2)cnc(C(=O)Nc2ccc(Cl)cc2)c1OC |
| InChI | InChI=1S/C20H17ClN4O2/c1-27-19-16(11-22)17(24-14-5-3-2-4-6-14)12-23-18(19)20(26)25-15-9-7-13(21)8-10-15/h2-12,22,24H,1H3,(H,25,26)/b22-11+ |
| InChIKey | QRVIZMWUNBKSFP-SSDVNMTOSA-N |
| XLogP | 4.74 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|