C16H18Cl2N8O — CID 145131118
4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-[[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]amino]pyridine-3-carboxamide (PubChem CID 145131118) has the molecular formula C16H18Cl2N8O and a molecular weight of 409.28 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-[[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]amino]pyridine-3-carboxamide.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-[[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 145131118 |
| Molecular Formula | C16H18Cl2N8O |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-5-ethanimidoyl-6-[[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]amino]pyridine-3-carboxamide |
| SMILES | [H]/N=C(\C)c1c(NC/C(=N/N)NN)ncc(C(=O)Nc2ccc(Cl)cc2)c1Cl |
| InChI | InChI=1S/C16H18Cl2N8O/c1-8(19)13-14(18)11(6-22-15(13)23-7-12(25-20)26-21)16(27)24-10-4-2-9(17)3-5-10/h2-6,19H,7,20-21H2,1H3,(H,22,23)(H,24,27)(H,25,26)/b19-8+ |
| InChIKey | KHHKADUQNLSVMX-UFWORHAWSA-N |
| XLogP | 2.18 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|