C12H13ClFN3O3 — CID 145130860
5-carbonofluorimidoyl-4-chloro-6-(oxan-4-ylamino)pyridine-3-carboxylic acid (PubChem CID 145130860) has the molecular formula C12H13ClFN3O3 and a molecular weight of 301.70 g/mol. Its IUPAC name is 5-carbonofluorimidoyl-4-chloro-6-(oxan-4-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-carbonofluorimidoyl-4-chloro-6-(oxan-4-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 145130860 |
| Molecular Formula | C12H13ClFN3O3 |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-carbonofluorimidoyl-4-chloro-6-(oxan-4-ylamino)pyridine-3-carboxylic acid |
| SMILES | [H]/N=C(\F)c1c(NC2CCOCC2)ncc(C(=O)O)c1Cl |
| InChI | InChI=1S/C12H13ClFN3O3/c13-9-7(12(18)19)5-16-11(8(9)10(14)15)17-6-1-3-20-4-2-6/h5-6,15H,1-4H2,(H,16,17)(H,18,19)/b15-10- |
| InChIKey | NEUPMHNVLMYFSO-GDNBJRDFSA-N |
| XLogP | 2.32 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|