C21H26ClN5O2 — CID 145130921
6-[[1-[[4-(aminomethyl)phenyl]methyl]piperidin-4-yl]amino]-4-chloro-5-ethanimidoylpyridine-3-carboxylic acid (PubChem CID 145130921) has the molecular formula C21H26ClN5O2 and a molecular weight of 415.93 g/mol. Its IUPAC name is 6-[[1-[[4-(aminomethyl)phenyl]methyl]piperidin-4-yl]amino]-4-chloro-5-ethanimidoylpyridine-3-carboxylic acid.
| Compound Name | 6-[[1-[[4-(aminomethyl)phenyl]methyl]piperidin-4-yl]amino]-4-chloro-5-ethanimidoylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 145130921 |
| Molecular Formula | C21H26ClN5O2 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 6-[[1-[[4-(aminomethyl)phenyl]methyl]piperidin-4-yl]amino]-4-chloro-5-ethanimidoylpyridine-3-carboxylic acid |
| SMILES | [H]/N=C(\C)c1c(NC2CCN(Cc3ccc(CN)cc3)CC2)ncc(C(=O)O)c1Cl |
| InChI | InChI=1S/C21H26ClN5O2/c1-13(24)18-19(22)17(21(28)29)11-25-20(18)26-16-6-8-27(9-7-16)12-15-4-2-14(10-23)3-5-15/h2-5,11,16,24H,6-10,12,23H2,1H3,(H,25,26)(H,28,29)/b24-13+ |
| InChIKey | JRVUXDANHSSQCB-ZMOGYAJESA-N |
| XLogP | 3.36 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|