C22H22ClF4N3O3 — CID 129177753
4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzoic acid (PubChem CID 129177753) has the molecular formula C22H22ClF4N3O3 and a molecular weight of 487.88 g/mol. Its IUPAC name is 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzoic acid.
| Compound Name | 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 129177753 |
| Molecular Formula | C22H22ClF4N3O3 |
| Molecular Weight | 487.88 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzoic acid |
| SMILES | [H]/N=C(\C)c1cc(C(=O)O)c(F)cc1NC1CCN(Cc2cc(Cl)cc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H22ClF4N3O3/c1-12(28)17-9-18(21(31)32)19(24)10-20(17)29-15-2-4-30(5-3-15)11-13-6-14(23)8-16(7-13)33-22(25,26)27/h6-10,15,28-29H,2-5,11H2,1H3,(H,31,32)/b28-12+ |
| InChIKey | AHKVNYHXFFSIRT-KVSWJAHQSA-N |
| XLogP | 5.54 |
| TPSA | 85.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|