C25H26ClF5N4OS — CID 145319296
4-[[1-[[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]-N-cyclopropylsulfanyl-5-ethanimidoyl-2-fluorobenzamide (PubChem CID 145319296) has the molecular formula C25H26ClF5N4OS and a molecular weight of 561.02 g/mol. Its IUPAC name is 4-[[1-[[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]-N-cyclopropylsulfanyl-5-ethanimidoyl-2-fluorobenzamide.
| Compound Name | 4-[[1-[[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]-N-cyclopropylsulfanyl-5-ethanimidoyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 145319296 |
| Molecular Formula | C25H26ClF5N4OS |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 4-[[1-[[3-chloro-2-fluoro-5-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]-N-cyclopropylsulfanyl-5-ethanimidoyl-2-fluorobenzamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NSC2CC2)c(F)cc1NC1CCN(Cc2cc(C(F)(F)F)cc(Cl)c2F)CC1 |
| InChI | InChI=1S/C25H26ClF5N4OS/c1-13(32)18-10-19(24(36)34-37-17-2-3-17)21(27)11-22(18)33-16-4-6-35(7-5-16)12-14-8-15(25(29,30)31)9-20(26)23(14)28/h8-11,16-17,32-33H,2-7,12H2,1H3,(H,34,36)/b32-13+ |
| InChIKey | SDRLJIZVJAEKHO-JJKQSNDFSA-N |
| XLogP | 6.64 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|