C21H21ClF4N4O2S — CID 145319301
4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]azetidin-3-yl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfanylbenzamide (PubChem CID 145319301) has the molecular formula C21H21ClF4N4O2S and a molecular weight of 504.94 g/mol. Its IUPAC name is 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]azetidin-3-yl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfanylbenzamide.
| Compound Name | 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]azetidin-3-yl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 145319301 |
| Molecular Formula | C21H21ClF4N4O2S |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-[[1-[[3-chloro-5-(trifluoromethoxy)phenyl]methyl]azetidin-3-yl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfanylbenzamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NSC)c(F)cc1NC1CN(Cc2cc(Cl)cc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H21ClF4N4O2S/c1-11(27)16-6-17(20(31)29-33-2)18(23)7-19(16)28-14-9-30(10-14)8-12-3-13(22)5-15(4-12)32-21(24,25)26/h3-7,14,27-28H,8-10H2,1-2H3,(H,29,31)/b27-11+ |
| InChIKey | BPNNBVBRHNRXIZ-LUOAPIJWSA-N |
| XLogP | 5.07 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|