C24H27Cl2FN4OS — CID 145319331
N-cyclopropylsulfanyl-4-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzamide (PubChem CID 145319331) has the molecular formula C24H27Cl2FN4OS and a molecular weight of 509.48 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-4-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzamide.
| Compound Name | N-cyclopropylsulfanyl-4-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 145319331 |
| Molecular Formula | C24H27Cl2FN4OS |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | N-cyclopropylsulfanyl-4-[[1-[(3,5-dichlorophenyl)methyl]piperidin-4-yl]amino]-5-ethanimidoyl-2-fluorobenzamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NSC2CC2)c(F)cc1NC1CCN(Cc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H27Cl2FN4OS/c1-14(28)20-11-21(24(32)30-33-19-2-3-19)22(27)12-23(20)29-18-4-6-31(7-5-18)13-15-8-16(25)10-17(26)9-15/h8-12,18-19,28-29H,2-7,13H2,1H3,(H,30,32)/b28-14+ |
| InChIKey | GVOYKUDXMKRFPS-CCVNUDIWSA-N |
| XLogP | 6.14 |
| TPSA | 68.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|