C21H26N4OS — CID 143163414
5-(cyclohexylamino)-N-(2,3-dihydro-1H-indol-5-yl)-4-ethanimidoylthiophene-2-carboxamide (PubChem CID 143163414) has the molecular formula C21H26N4OS and a molecular weight of 382.53 g/mol. Its IUPAC name is 5-(cyclohexylamino)-N-(2,3-dihydro-1H-indol-5-yl)-4-ethanimidoylthiophene-2-carboxamide.
| Compound Name | 5-(cyclohexylamino)-N-(2,3-dihydro-1H-indol-5-yl)-4-ethanimidoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143163414 |
| Molecular Formula | C21H26N4OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-(cyclohexylamino)-N-(2,3-dihydro-1H-indol-5-yl)-4-ethanimidoylthiophene-2-carboxamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)Nc2ccc3c(c2)CCN3)sc1NC1CCCCC1 |
| InChI | InChI=1S/C21H26N4OS/c1-13(22)17-12-19(27-21(17)25-15-5-3-2-4-6-15)20(26)24-16-7-8-18-14(11-16)9-10-23-18/h7-8,11-12,15,22-23,25H,2-6,9-10H2,1H3,(H,24,26)/b22-13+ |
| InChIKey | YDVJZLYTTPHWRG-LPYMAVHISA-N |
| XLogP | 5.10 |
| TPSA | 77.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|