About cyclohexanol;2,5-dimethyl-1H-pyrrole
cyclohexanol;2,5-dimethyl-1H-pyrrole (PubChem CID 145136198) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is cyclohexanol;2,5-dimethyl-1H-pyrrole.
Molecular Properties
| Compound Name | cyclohexanol;2,5-dimethyl-1H-pyrrole |
| PubChem CID | 145136198 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | cyclohexanol;2,5-dimethyl-1H-pyrrole |
| SMILES | Cc1ccc(C)[nH]1.OC1CCCCC1 |
| InChI | InChI=1S/C6H9N.C6H12O/c1-5-3-4-6(2)7-5;7-6-4-2-1-3-5-6/h3-4,7H,1-2H3;6-7H,1-5H2 |
| InChIKey | AGUYDJVADFHPCI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexanol;2,5-dimethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;2,5-dimethyl-1H-pyrrole?
The IUPAC name of cyclohexanol;2,5-dimethyl-1H-pyrrole (CID 145136198) is cyclohexanol;2,5-dimethyl-1H-pyrrole.
What is the SMILES notation for cyclohexanol;2,5-dimethyl-1H-pyrrole?
The canonical SMILES for cyclohexanol;2,5-dimethyl-1H-pyrrole is Cc1ccc(C)[nH]1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;2,5-dimethyl-1H-pyrrole?
The InChIKey is AGUYDJVADFHPCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C6H12O/c1-5-3-4-6(2)7-5;7-6-4-2-1-3-5-6/h3-4,7H,1-2H3;6-7H,1-5H2.
What are the key properties of cyclohexanol;2,5-dimethyl-1H-pyrrole?
cyclohexanol;2,5-dimethyl-1H-pyrrole has a molecular weight of 195.31 g/mol, XLogP of 2.94, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;2,5-dimethyl-1H-pyrrole is sourced from PubChem (CID 145136198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).