C11H20F2N2 — CID 145136469
2-(1,1-difluoroethyl)-5-methylpyrimidine;ethane (PubChem CID 145136469) has the molecular formula C11H20F2N2 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-5-methylpyrimidine;ethane.
| Compound Name | 2-(1,1-difluoroethyl)-5-methylpyrimidine;ethane |
|---|---|
| PubChem CID | 145136469 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-(1,1-difluoroethyl)-5-methylpyrimidine;ethane |
| SMILES | CC.CC.Cc1cnc(C(C)(F)F)nc1 |
| InChI | InChI=1S/C7H8F2N2.2C2H6/c1-5-3-10-6(11-4-5)7(2,8)9;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | JWKXNYQSEABIDI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |