C15H14F4N4O — CID 161462800
2-(1,1-difluoroethyl)-5-ethenylpyrimidine;2-(1,1-difluoroethyl)pyrimidine-5-carbaldehyde (PubChem CID 161462800) has the molecular formula C15H14F4N4O and a molecular weight of 342.30 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-5-ethenylpyrimidine;2-(1,1-difluoroethyl)pyrimidine-5-carbaldehyde.
| Compound Name | 2-(1,1-difluoroethyl)-5-ethenylpyrimidine;2-(1,1-difluoroethyl)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 161462800 |
| Molecular Formula | C15H14F4N4O |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-(1,1-difluoroethyl)-5-ethenylpyrimidine;2-(1,1-difluoroethyl)pyrimidine-5-carbaldehyde |
| SMILES | C=Cc1cnc(C(C)(F)F)nc1.CC(F)(F)c1ncc(C=O)cn1 |
| InChI | InChI=1S/C8H8F2N2.C7H6F2N2O/c1-3-6-4-11-7(12-5-6)8(2,9)10;1-7(8,9)6-10-2-5(4-12)3-11-6/h3-5H,1H2,2H3;2-4H,1H3 |
| InChIKey | WCAPYXCLUQIPAP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|