C16H17N — CID 145138026
N-[(2E,4Z)-hexa-2,4-dien-2-yl]naphthalen-2-amine (PubChem CID 145138026) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-2-yl]naphthalen-2-amine.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-2-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 145138026 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-2-yl]naphthalen-2-amine |
| SMILES | C/C=C\C=C(/C)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17N/c1-3-4-7-13(2)17-16-11-10-14-8-5-6-9-15(14)12-16/h3-12,17H,1-2H3/b4-3-,13-7+ |
| InChIKey | IHGYVLIOYISIOK-XYJZBGMCSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|