C16H17N — CID 123968148
N-hexa-2,4-dienylnaphthalen-2-amine (PubChem CID 123968148) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is N-hexa-2,4-dienylnaphthalen-2-amine.
| Compound Name | N-hexa-2,4-dienylnaphthalen-2-amine |
|---|---|
| PubChem CID | 123968148 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-hexa-2,4-dienylnaphthalen-2-amine |
| SMILES | CC=CC=CCNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17N/c1-2-3-4-7-12-17-16-11-10-14-8-5-6-9-15(14)13-16/h2-11,13,17H,12H2,1H3 |
| InChIKey | CDHXSZPCZCWACE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|