C12H17NOS — CID 145138544
2-(3,4-dihydro-1H-isochromen-1-yl)azetidine;sulfane (PubChem CID 145138544) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-1-yl)azetidine;sulfane.
| Compound Name | 2-(3,4-dihydro-1H-isochromen-1-yl)azetidine;sulfane |
|---|---|
| PubChem CID | 145138544 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(3,4-dihydro-1H-isochromen-1-yl)azetidine;sulfane |
| SMILES | S.c1ccc2c(c1)CCOC2C1CCN1 |
| InChI | InChI=1S/C12H15NO.H2S/c1-2-4-10-9(3-1)6-8-14-12(10)11-5-7-13-11;/h1-4,11-13H,5-8H2;1H2 |
| InChIKey | JGYJOKZQWLBPTR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |