C18H29FN2O4S — CID 145138996
ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanol (PubChem CID 145138996) has the molecular formula C18H29FN2O4S and a molecular weight of 388.51 g/mol. Its IUPAC name is ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanol.
| Compound Name | ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanol |
|---|---|
| PubChem CID | 145138996 |
| Molecular Formula | C18H29FN2O4S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanol |
| SMILES | CC.CSCCO.O=C(NCC(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O3.C3H8OS.C2H6/c14-11-3-1-10(2-4-11)13(18)15-9-12(17)16-5-7-19-8-6-16;1-5-3-2-4;1-2/h1-4H,5-9H2,(H,15,18);4H,2-3H2,1H3;1-2H3 |
| InChIKey | RFWXXCIVBYGOSI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |