C18H30FN3O3S — CID 145139009
ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanamine (PubChem CID 145139009) has the molecular formula C18H30FN3O3S and a molecular weight of 387.52 g/mol. Its IUPAC name is ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanamine.
| Compound Name | ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 145139009 |
| Molecular Formula | C18H30FN3O3S |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | ethane;4-fluoro-N-(2-morpholin-4-yl-2-oxoethyl)benzamide;2-methylsulfanylethanamine |
| SMILES | CC.CSCCN.O=C(NCC(=O)N1CCOCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2O3.C3H9NS.C2H6/c14-11-3-1-10(2-4-11)13(18)15-9-12(17)16-5-7-19-8-6-16;1-5-3-2-4;1-2/h1-4H,5-9H2,(H,15,18);2-4H2,1H3;1-2H3 |
| InChIKey | IYFDSDQDFYYOEJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |