C19H28FN3O — CID 145139053
5-[[2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)pentan-1-one (PubChem CID 145139053) has the molecular formula C19H28FN3O and a molecular weight of 333.45 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)pentan-1-one.
| Compound Name | 5-[[2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 145139053 |
| Molecular Formula | C19H28FN3O |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)cyclopropyl]amino]-1-(4-methylpiperazin-1-yl)pentan-1-one |
| SMILES | CN1CCN(C(=O)CCCCNC2CC2c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H28FN3O/c1-22-10-12-23(13-11-22)19(24)4-2-3-9-21-18-14-17(18)15-5-7-16(20)8-6-15/h5-8,17-18,21H,2-4,9-14H2,1H3 |
| InChIKey | NOEQYPNURGYRMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|