C17H14FN3 — CID 145139348
(Z)-N'-(4-fluorophenyl)-1-quinolin-2-ylethene-1,2-diamine (PubChem CID 145139348) has the molecular formula C17H14FN3 and a molecular weight of 279.32 g/mol. Its IUPAC name is (Z)-N'-(4-fluorophenyl)-1-quinolin-2-ylethene-1,2-diamine.
| Compound Name | (Z)-N'-(4-fluorophenyl)-1-quinolin-2-ylethene-1,2-diamine |
|---|---|
| PubChem CID | 145139348 |
| Molecular Formula | C17H14FN3 |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (Z)-N'-(4-fluorophenyl)-1-quinolin-2-ylethene-1,2-diamine |
| SMILES | N/C(=C\Nc1ccc(F)cc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C17H14FN3/c18-13-6-8-14(9-7-13)20-11-15(19)17-10-5-12-3-1-2-4-16(12)21-17/h1-11,20H,19H2/b15-11- |
| InChIKey | IJHDIWSXPWMTBV-PTNGSMBKSA-N |
| XLogP | 3.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |