C20H27NO8 — CID 145142168
3-[[2-(3,4-dimethoxyphenyl)-2,2-dihydroxyethyl]amino]-1-(3-methylphenoxy)propane-1,1,2-triol (PubChem CID 145142168) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethoxyphenyl)-2,2-dihydroxyethyl]amino]-1-(3-methylphenoxy)propane-1,1,2-triol.
| Compound Name | 3-[[2-(3,4-dimethoxyphenyl)-2,2-dihydroxyethyl]amino]-1-(3-methylphenoxy)propane-1,1,2-triol |
|---|---|
| PubChem CID | 145142168 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-[[2-(3,4-dimethoxyphenyl)-2,2-dihydroxyethyl]amino]-1-(3-methylphenoxy)propane-1,1,2-triol |
| SMILES | COc1ccc(C(O)(O)CNCC(O)C(O)(O)Oc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C20H27NO8/c1-13-5-4-6-15(9-13)29-20(25,26)18(22)11-21-12-19(23,24)14-7-8-16(27-2)17(10-14)28-3/h4-10,18,21-26H,11-12H2,1-3H3 |
| InChIKey | KIXWLLSEHLMJOR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|