C20H25B2NO4 — CID 145142158
CID 145142158 (PubChem CID 145142158) has the molecular formula C20H25B2NO4 and a molecular weight of 365.05 g/mol.
| Compound Name | CID 145142158 |
|---|---|
| PubChem CID | 145142158 |
| Molecular Formula | C20H25B2NO4 |
| Molecular Weight | 365.05 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])(Oc1cccc(C)c1)C(O)CNCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25B2NO4/c1-14-5-4-6-16(11-14)27-20(21,22)19(24)13-23-10-9-15-7-8-17(25-2)18(12-15)26-3/h4-8,11-12,19,23-24H,9-10,13H2,1-3H3 |
| InChIKey | LLWBGTBQEZHTFM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.05 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|