C20H26N2O4 — CID 23256616
(NZ)-N-[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ylidene]hydroxylamine (PubChem CID 23256616) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is (NZ)-N-[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 23256616 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (NZ)-N-[1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(3-methylphenoxy)propan-2-ylidene]hydroxylamine |
| SMILES | COc1ccc(CCNC/C(COc2cccc(C)c2)=N/O)cc1OC |
| InChI | InChI=1S/C20H26N2O4/c1-15-5-4-6-18(11-15)26-14-17(22-23)13-21-10-9-16-7-8-19(24-2)20(12-16)25-3/h4-8,11-12,21,23H,9-10,13-14H2,1-3H3/b22-17- |
| InChIKey | VZRGKBAHXYJNAT-XLNRJJMWSA-N |
| XLogP | 3.05 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|