C12H28O6 — CID 145143848
2-ethoxypropan-2-ol;oxolan-2-ol;propane-2,2-diol (PubChem CID 145143848) has the molecular formula C12H28O6 and a molecular weight of 268.35 g/mol. Its IUPAC name is 2-ethoxypropan-2-ol;oxolan-2-ol;propane-2,2-diol.
| Compound Name | 2-ethoxypropan-2-ol;oxolan-2-ol;propane-2,2-diol |
|---|---|
| PubChem CID | 145143848 |
| Molecular Formula | C12H28O6 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-ethoxypropan-2-ol;oxolan-2-ol;propane-2,2-diol |
| SMILES | CC(C)(O)O.CCOC(C)(C)O.OC1CCCO1 |
| InChI | InChI=1S/C5H12O2.C4H8O2.C3H8O2/c1-4-7-5(2,3)6;5-4-2-1-3-6-4;1-3(2,4)5/h6H,4H2,1-3H3;4-5H,1-3H2;4-5H,1-2H3 |
| InChIKey | TUCZJVCWBUAFMK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|