C28H27N5O3S2 — CID 145146206
(3E,5E)-6-[4-[[5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-3-methylocta-1,3,5-trien-2-ol (PubChem CID 145146206) has the molecular formula C28H27N5O3S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is (3E,5E)-6-[4-[[5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-3-methylocta-1,3,5-trien-2-ol.
| Compound Name | (3E,5E)-6-[4-[[5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-3-methylocta-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 145146206 |
| Molecular Formula | C28H27N5O3S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | (3E,5E)-6-[4-[[5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]oxymethyl]-1,3-thiazol-2-yl]-3-methylocta-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C(C)=C/C=C(\CC)c1nc(COc2cc(OC)cc3nc(-c4cn5nc(C)ccc5n4)sc23)cs1 |
| InChI | InChI=1S/C28H27N5O3S2/c1-6-19(9-7-16(2)18(4)34)27-29-20(15-37-27)14-36-24-12-21(35-5)11-22-26(24)38-28(31-22)23-13-33-25(30-23)10-8-17(3)32-33/h7-13,15,34H,4,6,14H2,1-3,5H3/b16-7+,19-9+ |
| InChIKey | RHXJJECXSYUXEV-MZVFHJFQSA-N |
| XLogP | 7.17 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|