C15H13BN4O3S — CID 140841575
[5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]boronic acid (PubChem CID 140841575) has the molecular formula C15H13BN4O3S and a molecular weight of 340.17 g/mol. Its IUPAC name is [5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]boronic acid.
| Compound Name | [5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]boronic acid |
|---|---|
| PubChem CID | 140841575 |
| Molecular Formula | C15H13BN4O3S |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [5-methoxy-2-(6-methylimidazo[1,2-b]pyridazin-2-yl)-1,3-benzothiazol-7-yl]boronic acid |
| SMILES | COc1cc(B(O)O)c2sc(-c3cn4nc(C)ccc4n3)nc2c1 |
| InChI | InChI=1S/C15H13BN4O3S/c1-8-3-4-13-17-12(7-20(13)19-8)15-18-11-6-9(23-2)5-10(16(21)22)14(11)24-15/h3-7,21-22H,1-2H3 |
| InChIKey | CICBRISYZHXECP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|