C15H27NO — CID 145147974
cyclohexyl-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone;ethane (PubChem CID 145147974) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is cyclohexyl-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone;ethane.
| Compound Name | cyclohexyl-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone;ethane |
|---|---|
| PubChem CID | 145147974 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | cyclohexyl-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone;ethane |
| SMILES | CC.CC1=CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C13H21NO.C2H6/c1-11-7-9-14(10-8-11)13(15)12-5-3-2-4-6-12;1-2/h7,12H,2-6,8-10H2,1H3;1-2H3 |
| InChIKey | KFQAKWBCUVWOGU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|