C19H21BO2S — CID 145148588
ethane;[2-ethenyl-1-[(Z)-prop-1-enyl]dibenzothiophen-3-yl]boronic acid (PubChem CID 145148588) has the molecular formula C19H21BO2S and a molecular weight of 324.25 g/mol. Its IUPAC name is ethane;[2-ethenyl-1-[(Z)-prop-1-enyl]dibenzothiophen-3-yl]boronic acid.
| Compound Name | ethane;[2-ethenyl-1-[(Z)-prop-1-enyl]dibenzothiophen-3-yl]boronic acid |
|---|---|
| PubChem CID | 145148588 |
| Molecular Formula | C19H21BO2S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | ethane;[2-ethenyl-1-[(Z)-prop-1-enyl]dibenzothiophen-3-yl]boronic acid |
| SMILES | C=Cc1c(B(O)O)cc2sc3ccccc3c2c1/C=C\C.CC |
| InChI | InChI=1S/C17H15BO2S.C2H6/c1-3-7-12-11(4-2)14(18(19)20)10-16-17(12)13-8-5-6-9-15(13)21-16;1-2/h3-10,19-20H,2H2,1H3;1-2H3/b7-3-; |
| InChIKey | MMCQBVQXAVAJCJ-WYLUAFJRSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|