C11H17N — CID 145148945
7,7-dimethyl-1,2,3,9a-tetrahydropyrrolo[1,2-a]azepine (PubChem CID 145148945) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 7,7-dimethyl-1,2,3,9a-tetrahydropyrrolo[1,2-a]azepine.
| Compound Name | 7,7-dimethyl-1,2,3,9a-tetrahydropyrrolo[1,2-a]azepine |
|---|---|
| PubChem CID | 145148945 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 7,7-dimethyl-1,2,3,9a-tetrahydropyrrolo[1,2-a]azepine |
| SMILES | CC1(C)C=CC2CCCN2C=C1 |
| InChI | InChI=1S/C11H17N/c1-11(2)6-5-10-4-3-8-12(10)9-7-11/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | PEEWGKLSIYGADI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|