About 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine
2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine (PubChem CID 14317476) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine.
Analyze 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine?
The IUPAC name of 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine (CID 14317476) is 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine.
What is the SMILES notation for 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine?
The canonical SMILES for 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine is CC1=NC2CCCN2C=C1.
What is the InChIKey of 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine?
The InChIKey is HJQUWSWHWRPLGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-7-4-6-10-5-2-3-8(10)9-7/h4,6,8H,2-3,5H2,1H3.
What are the key properties of 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine?
2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine has a molecular weight of 136.20 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine is sourced from PubChem (CID 14317476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).