C11H15NO2 — CID 155455203
(3Z)-4,10-dimethyl-6-methylidene-2-oxa-10-azabicyclo[5.2.1]dec-3-en-5-one (PubChem CID 155455203) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3Z)-4,10-dimethyl-6-methylidene-2-oxa-10-azabicyclo[5.2.1]dec-3-en-5-one.
| Compound Name | (3Z)-4,10-dimethyl-6-methylidene-2-oxa-10-azabicyclo[5.2.1]dec-3-en-5-one |
|---|---|
| PubChem CID | 155455203 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3Z)-4,10-dimethyl-6-methylidene-2-oxa-10-azabicyclo[5.2.1]dec-3-en-5-one |
| SMILES | C=C1C(=O)/C(C)=C\OC2CCC1N2C |
| InChI | InChI=1S/C11H15NO2/c1-7-6-14-10-5-4-9(12(10)3)8(2)11(7)13/h6,9-10H,2,4-5H2,1,3H3/b7-6- |
| InChIKey | OAXQBPZCFAZKHC-SREVYHEPSA-N |
| XLogP | 1.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|