C21H36N2O4 — CID 145149644
[2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-2,6,8-trimethyldeca-2,8-dienoate (PubChem CID 145149644) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-2,6,8-trimethyldeca-2,8-dienoate.
| Compound Name | [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-2,6,8-trimethyldeca-2,8-dienoate |
|---|---|
| PubChem CID | 145149644 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-2,6,8-trimethyldeca-2,8-dienoate |
| SMILES | C/C=C(\C)CC(C)CC/C=C(\C)C(=O)OCC(=O)NC(C)C(=O)N(C)CC |
| InChI | InChI=1S/C21H36N2O4/c1-8-15(3)13-16(4)11-10-12-17(5)21(26)27-14-19(24)22-18(6)20(25)23(7)9-2/h8,12,16,18H,9-11,13-14H2,1-7H3,(H,22,24)/b15-8+,17-12+ |
| InChIKey | PLRZSUXLSJBVJW-SZLFEGQVSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|