C20H34N2O4 — CID 145149731
[2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-6,8-dimethyldeca-2,8-dienoate (PubChem CID 145149731) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-6,8-dimethyldeca-2,8-dienoate.
| Compound Name | [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-6,8-dimethyldeca-2,8-dienoate |
|---|---|
| PubChem CID | 145149731 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | [2-[[1-[ethyl(methyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl] (2E,8E)-6,8-dimethyldeca-2,8-dienoate |
| SMILES | C/C=C(\C)CC(C)CC/C=C/C(=O)OCC(=O)NC(C)C(=O)N(C)CC |
| InChI | InChI=1S/C20H34N2O4/c1-7-15(3)13-16(4)11-9-10-12-19(24)26-14-18(23)21-17(5)20(25)22(6)8-2/h7,10,12,16-17H,8-9,11,13-14H2,1-6H3,(H,21,23)/b12-10+,15-7+ |
| InChIKey | CWFIRQGWRNWAKV-NVWYFGKQSA-N |
| XLogP | 2.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|