C25H34N8O6 — CID 145150677
2-[[3-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-5-(diaminomethylideneamino)pentanoic acid;4-methylphenol (PubChem CID 145150677) has the molecular formula C25H34N8O6 and a molecular weight of 542.60 g/mol. Its IUPAC name is 2-[[3-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-5-(diaminomethylideneamino)pentanoic acid;4-methylphenol.
| Compound Name | 2-[[3-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-5-(diaminomethylideneamino)pentanoic acid;4-methylphenol |
|---|---|
| PubChem CID | 145150677 |
| Molecular Formula | C25H34N8O6 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 2-[[3-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-5-(diaminomethylideneamino)pentanoic acid;4-methylphenol |
| SMILES | Cc1ccc(O)cc1.NC(N)=NCCCC(NC(=O)NCc1nc(C(N)Cc2ccc(O)cc2)no1)C(=O)O |
| InChI | InChI=1S/C18H26N8O5.C7H8O/c19-12(8-10-3-5-11(27)6-4-10)15-25-14(31-26-15)9-23-18(30)24-13(16(28)29)2-1-7-22-17(20)21;1-6-2-4-7(8)5-3-6/h3-6,12-13,27H,1-2,7-9,19H2,(H,28,29)(H4,20,21,22)(H2,23,24,30);2-5,8H,1H3 |
| InChIKey | QSWIVFKMRGYFHH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 248.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|